EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9O3 |
| Net Charge | -1 |
| Average Mass | 165.168 |
| Monoisotopic Mass | 165.05572 |
| SMILES | O=C([O-])[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/p-1/t8-/m1/s1 |
| InChIKey | VOXXWSYKYCBWHO-MRVPVSSYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3-phenyllactate (CHEBI:11009) is a (2R)-2-hydroxy monocarboxylic acid anion (CHEBI:58314) |
| (R)-3-phenyllactate (CHEBI:11009) is a 3-phenyllactate (CHEBI:8100) |
| (R)-3-phenyllactate (CHEBI:11009) is conjugate base of (R)-3-phenyllactic acid (CHEBI:32978) |
| (R)-3-phenyllactate (CHEBI:11009) is enantiomer of (S)-3-phenyllactate (CHEBI:32979) |
| Incoming Relation(s) |
| (R)-3-phenyllactic acid (CHEBI:32978) is conjugate acid of (R)-3-phenyllactate (CHEBI:11009) |
| (S)-3-phenyllactate (CHEBI:32979) is enantiomer of (R)-3-phenyllactate (CHEBI:11009) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-3-phenylpropanoate |
| UniProt Name | Source |
|---|---|
| (R)-3-phenyllactate | UniProt |