EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | O=C(O)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12) |
| InChIKey | VOXXWSYKYCBWHO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-phenyllactic acid (CHEBI:25998) has functional parent rac-lactic acid (CHEBI:28358) |
| 3-phenyllactic acid (CHEBI:25998) has role human metabolite (CHEBI:77746) |
| 3-phenyllactic acid (CHEBI:25998) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| 3-phenyllactic acid (CHEBI:25998) is conjugate acid of 3-phenyllactate (CHEBI:8100) |
| Incoming Relation(s) |
| (R)-3-phenyllactic acid (CHEBI:32978) is a 3-phenyllactic acid (CHEBI:25998) |
| (S)-3-phenyllactic acid (CHEBI:43065) is a 3-phenyllactic acid (CHEBI:25998) |
| 3-phenyllactate (CHEBI:8100) is conjugate base of 3-phenyllactic acid (CHEBI:25998) |
| IUPAC Name |
|---|
| 2-hydroxy-3-phenylpropanoic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxy-3-phenylpropionic acid | ChEBI |
| DL-3-phenyllactic acid | ChemIDplus |
| DL-β-phenyllactic acid | ChemIDplus |
| β-phenyllactic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-7999 | MetaCyc |
| HMDB0000779 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2209791 | Reaxys |
| CAS:828-01-3 | ChemIDplus |
| Citations |
|---|