EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6NO3 |
| Net Charge | -1 |
| Average Mass | 104.085 |
| Monoisotopic Mass | 104.03532 |
| SMILES | N[C@@H](CO)C(=O)[O-] |
| InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/p-1/t2-/m0/s1 |
| InChIKey | MTCFGRXMJLQNBG-REOHCLBHSA-M |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-serinate (CHEBI:32836) is a L-α-amino acid anion (CHEBI:59814) |
| L-serinate (CHEBI:32836) is a serinate (CHEBI:32845) |
| L-serinate (CHEBI:32836) is conjugate base of L-serine (CHEBI:17115) |
| L-serinate (CHEBI:32836) is enantiomer of D-serinate (CHEBI:32840) |
| Incoming Relation(s) |
| N-(fatty acyl)-L-serine(1−) (CHEBI:149698) has functional parent L-serinate (CHEBI:32836) |
| L-serine (CHEBI:17115) is conjugate acid of L-serinate (CHEBI:32836) |
| D-serinate (CHEBI:32840) is enantiomer of L-serinate (CHEBI:32836) |
| IUPAC Name |
|---|
| L-serinate |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-hydroxypropanoate | IUPAC |
| L-serine anion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:324693 | Gmelin |
| Beilstein:4372751 | Beilstein |