EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4O5 |
| Net Charge | -2 |
| Average Mass | 156.093 |
| Monoisotopic Mass | 156.00697 |
| SMILES | O=C([O-])/C=C\CC(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H6O5/c7-4(6(10)11)2-1-3-5(8)9/h1,3H,2H2,(H,8,9)(H,10,11)/p-2/b3-1- |
| InChIKey | OOEDHTCVMHDXRH-IWQZZHSRSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-5-oxohex-2-enedioate (CHEBI:16967) has functional parent hex-2-enedioate (CHEBI:25781) |
| (Z)-5-oxohex-2-enedioate (CHEBI:16967) is a oxo dicarboxylate (CHEBI:36147) |
| (Z)-5-oxohex-2-enedioate (CHEBI:16967) is conjugate base of (Z)-5-oxohex-2-enedioic acid (CHEBI:32808) |
| Incoming Relation(s) |
| (Z)-5-oxohex-2-enedioic acid (CHEBI:32808) is conjugate acid of (Z)-5-oxohex-2-enedioate (CHEBI:16967) |
| IUPAC Name |
|---|
| (2Z)-5-oxohex-2-enedioate |
| Synonyms | Source |
|---|---|
| (Z)-5-oxohex-2-enedioate | ChEBI |
| gamma-oxalocrotonate | ChEBI |
| UniProt Name | Source |
|---|---|
| (Z)-5-oxohex-2-enedioate | UniProt |
| Citations |
|---|