EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO3 |
| Net Charge | +1 |
| Average Mass | 181.191 |
| Monoisotopic Mass | 181.07334 |
| SMILES | N[C@@H](Cc1ccc([OH+])cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/q+1/t8-/m0/s1 |
| InChIKey | MULVJZGDDYHMNG-QMMMGPOBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tyrosinyl radical cation (CHEBI:32763) has functional parent L-tyrosine (CHEBI:17895) |
| L-tyrosinyl radical cation (CHEBI:32763) is a tyrosinyl radical cation (CHEBI:32787) |
| L-tyrosinyl radical cation (CHEBI:32763) is conjugate acid of L-tyrosinyl radical (CHEBI:32759) |
| L-tyrosinyl radical cation (CHEBI:32763) is enantiomer of D-tyrosinyl radical cation (CHEBI:32776) |
| Incoming Relation(s) |
| L-tyrosinyl radical (CHEBI:32759) is conjugate base of L-tyrosinyl radical cation (CHEBI:32763) |
| D-tyrosinyl radical cation (CHEBI:32776) is enantiomer of L-tyrosinyl radical cation (CHEBI:32763) |
| L-tyrosinyl radical cation residue (CHEBI:32767) is substituent group from L-tyrosinyl radical cation (CHEBI:32763) |
| IUPAC Name |
|---|
| {4-[(2S)-2-amino-2-carboxyethyl]phenyl}oxidaniumyl |
| Synonyms | Source |
|---|---|
| L-tyrosine radical cation | ChEBI |
| L-tyrosine cation radical | ChEBI |
| L-tyrosine(•1+) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8993814 | Beilstein |