EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10NO3 |
| Net Charge | 0 |
| Average Mass | 180.183 |
| Monoisotopic Mass | 180.06607 |
| SMILES | N[C@@H](Cc1ccc([O])cc1)C(=O)O |
| InChI | InChI=1S/C9H10NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8H,5,10H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | BSOLAQMZTBVZLA-QMMMGPOBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tyrosinyl radical (CHEBI:32759) has functional parent L-tyrosine (CHEBI:17895) |
| L-tyrosinyl radical (CHEBI:32759) is a tyrosinyl radical (CHEBI:32783) |
| L-tyrosinyl radical (CHEBI:32759) is conjugate base of L-tyrosinyl radical cation (CHEBI:32763) |
| L-tyrosinyl radical (CHEBI:32759) is enantiomer of D-tyrosinyl radical (CHEBI:32777) |
| Incoming Relation(s) |
| L-tyrosinyl radical cation (CHEBI:32763) is conjugate acid of L-tyrosinyl radical (CHEBI:32759) |
| D-tyrosinyl radical (CHEBI:32777) is enantiomer of L-tyrosinyl radical (CHEBI:32759) |
| L-tyrosinyl radical residue (CHEBI:32766) is substituent group from L-tyrosinyl radical (CHEBI:32759) |
| IUPAC Name |
|---|
| {4-[(2S)-2-amino-2-carboxyethyl]phenyl}oxidanyl |
| Synonyms | Source |
|---|---|
| L-tyrosine radical | ChEBI |
| L-tyrosine(•) | ChEBI |
| L-tyrosinyl | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2941070 | Beilstein |