EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O2 |
| Net Charge | +1 |
| Average Mass | 204.229 |
| Monoisotopic Mass | 204.08933 |
| SMILES | N[C@@H](CC1=C[NH+]c2ccccc21)C(=O)O |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/q+1/t9-/m0/s1 |
| InChIKey | HVGYHDAURCWJGF-VIFPVBQESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tryptophanyl radical cation (CHEBI:32713) has functional parent L-tryptophan (CHEBI:16828) |
| L-tryptophanyl radical cation (CHEBI:32713) is a tryptophanyl radical cation (CHEBI:32729) |
| L-tryptophanyl radical cation (CHEBI:32713) is conjugate acid of L-tryptophanyl radical (CHEBI:32712) |
| L-tryptophanyl radical cation (CHEBI:32713) is enantiomer of D-tryptophanyl radical cation (CHEBI:32724) |
| Incoming Relation(s) |
| L-tryptophanyl radical (CHEBI:32712) is conjugate base of L-tryptophanyl radical cation (CHEBI:32713) |
| D-tryptophanyl radical cation (CHEBI:32724) is enantiomer of L-tryptophanyl radical cation (CHEBI:32713) |
| L-tryptophanyl radical cation residue (CHEBI:32715) is substituent group from L-tryptophanyl radical cation (CHEBI:32713) |
| IUPAC Name |
|---|
| 3-[(2S)-2-amino-2-carboxyethyl]-1H-indol-1-ium-1-yl |
| Synonyms | Source |
|---|---|
| L-tryptophan(•1+) | ChEBI |
| L-tryptophan cation radical | ChEBI |
| L-tryptophan radical cation | ChEBI |
| L-tryptophanyl cation radical | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6338890 | Beilstein |
| Beilstein:6420752 | Beilstein |