EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32631 - L-methioninate
| Formula | C5H10NO2S |
| Net Charge | -1 |
| Average Mass | 148.207 |
| Monoisotopic Mass | 148.04377 |
| SMILES | CSCC[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/p-1/t4-/m0/s1 |
| InChIKey | FFEARJCKVFRZRR-BYPYZUCNSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (24939187) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (5764336) |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-methioninate (CHEBI:32631) has role Escherichia coli metabolite (CHEBI:76971) |
| L-methioninate (CHEBI:32631) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-methioninate (CHEBI:32631) has role plant metabolite (CHEBI:76924) |
| L-methioninate (CHEBI:32631) is a methioninate (CHEBI:32644) |
| L-methioninate (CHEBI:32631) is conjugate base of L-methionine (CHEBI:16643) |
| L-methioninate (CHEBI:32631) is enantiomer of D-methioninate (CHEBI:32637) |
| Incoming Relation(s) |
| S-adenosyl-L-methioninate (CHEBI:67040) has functional parent L-methioninate (CHEBI:32631) |
| S-methyl-L-methioninate (CHEBI:67050) has functional parent L-methioninate (CHEBI:32631) |
| L-methionine (CHEBI:16643) is conjugate acid of L-methioninate (CHEBI:32631) |
| D-methioninate (CHEBI:32637) is enantiomer of L-methioninate (CHEBI:32631) |
| IUPAC Name |
|---|
| L-methioninate |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-4-(methylsulfanyl)butanoate | IUPAC |
| L-methionine anion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:326566 | Gmelin |
| Reaxys:4740675 | Reaxys |