EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2S |
| Net Charge | 0 |
| Average Mass | 163.242 |
| Monoisotopic Mass | 163.06670 |
| SMILES | C[S+](C)CC[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C6H13NO2S/c1-10(2)4-3-5(7)6(8)9/h5H,3-4,7H2,1-2H3/t5-/m0/s1 |
| InChIKey | YDBYJHTYSHBBAU-YFKPBYRVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-methyl-L-methioninate (CHEBI:67050) has functional parent L-methioninate (CHEBI:32631) |
| S-methyl-L-methioninate (CHEBI:67050) is a methyl-L-methionine (CHEBI:25268) |
| S-methyl-L-methioninate (CHEBI:67050) is a sulfonium betaine (CHEBI:35282) |
| S-methyl-L-methioninate (CHEBI:67050) is conjugate base of S-methyl-L-methionine (CHEBI:17728) |
| Incoming Relation(s) |
| S-methyl-L-methionine (CHEBI:17728) is conjugate acid of S-methyl-L-methioninate (CHEBI:67050) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-(dimethylsulfonio)butanoate |