EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10NO2 |
| Net Charge | -1 |
| Average Mass | 164.184 |
| Monoisotopic Mass | 164.07170 |
| SMILES | NC(Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/p-1 |
| InChIKey | COLNVLDHVKWLRT-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylalaninate (CHEBI:32504) is a aromatic amino-acid anion (CHEBI:63473) |
| phenylalaninate (CHEBI:32504) is a α-amino-acid anion (CHEBI:33558) |
| phenylalaninate (CHEBI:32504) is conjugate base of phenylalanine (CHEBI:28044) |
| Incoming Relation(s) |
| D-phenylalaninate (CHEBI:32494) is a phenylalaninate (CHEBI:32504) |
| L-phenylalaninate (CHEBI:32486) is a phenylalaninate (CHEBI:32504) |
| phenylalanine (CHEBI:28044) is conjugate acid of phenylalaninate (CHEBI:32504) |
| IUPAC Name |
|---|
| phenylalaninate |
| Synonyms | Source |
|---|---|
| 2-amino-3-phenylpropanoate | IUPAC |
| phenylalanine anion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:329083 | Gmelin |