EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10NO2 |
| Net Charge | -1 |
| Average Mass | 164.184 |
| Monoisotopic Mass | 164.07170 |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/p-1/t8-/m0/s1 |
| InChIKey | COLNVLDHVKWLRT-QMMMGPOBSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (24966042) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24733517) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-phenylalaninate (CHEBI:32486) has role Escherichia coli metabolite (CHEBI:76971) |
| L-phenylalaninate (CHEBI:32486) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-phenylalaninate (CHEBI:32486) has role plant metabolite (CHEBI:76924) |
| L-phenylalaninate (CHEBI:32486) is a L-α-amino acid anion (CHEBI:59814) |
| L-phenylalaninate (CHEBI:32486) is a phenylalaninate (CHEBI:32504) |
| L-phenylalaninate (CHEBI:32486) is conjugate base of L-phenylalanine (CHEBI:17295) |
| L-phenylalaninate (CHEBI:32486) is enantiomer of D-phenylalaninate (CHEBI:32494) |
| Incoming Relation(s) |
| N-acetyl-L-phenylalaninate (CHEBI:57702) has functional parent L-phenylalaninate (CHEBI:32486) |
| L-phenylalanine (CHEBI:17295) is conjugate acid of L-phenylalaninate (CHEBI:32486) |
| D-phenylalaninate (CHEBI:32494) is enantiomer of L-phenylalaninate (CHEBI:32486) |
| IUPAC Name |
|---|
| L-phenylalaninate |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-phenylpropanoate | IUPAC |
| L-phenylalanine anion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:329084 | Gmelin |
| Reaxys:4136718 | Reaxys |
| Citations |
|---|