EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34O7 |
| Net Charge | 0 |
| Average Mass | 458.551 |
| Monoisotopic Mass | 458.23045 |
| SMILES | [H][C@]1([C@@]2(C)O[C@]2([H])CC=C(C)C)[C@H](OC)[C@H](OC(=O)/C=C/C=C/C=C/C=C/C(=O)O)CC[C@]12CO2 |
| InChI | InChI=1S/C26H34O7/c1-18(2)13-14-20-25(3,33-20)24-23(30-4)19(15-16-26(24)17-31-26)32-22(29)12-10-8-6-5-7-9-11-21(27)28/h5-13,19-20,23-24H,14-17H2,1-4H3,(H,27,28)/b7-5+,8-6+,11-9+,12-10+/t19-,20-,23-,24-,25+,26+/m1/s1 |
| InChIKey | NGGMYCMLYOUNGM-CSDLUJIJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antibacterial drug A drug used to treat or prevent bacterial infections. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. methionine aminopeptidase 2 inhibitor Any methionyl aminopeptidase inhibitor that inhibits the action of methionyl aminopeptidase 2. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antibacterial drug A drug used to treat or prevent bacterial infections. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fumagillin (CHEBI:48635) has functional parent (all-E)-deca-2,4,6,8-tetraenedioic acid (CHEBI:49057) |
| fumagillin (CHEBI:48635) has functional parent fumagillol (CHEBI:324935) |
| fumagillin (CHEBI:48635) has role angiogenesis inhibitor (CHEBI:48422) |
| fumagillin (CHEBI:48635) has role antibacterial drug (CHEBI:36047) |
| fumagillin (CHEBI:48635) has role antimicrobial agent (CHEBI:33281) |
| fumagillin (CHEBI:48635) has role antiprotozoal drug (CHEBI:35820) |
| fumagillin (CHEBI:48635) has role fungal metabolite (CHEBI:76946) |
| fumagillin (CHEBI:48635) has role methionine aminopeptidase 2 inhibitor (CHEBI:73361) |
| fumagillin (CHEBI:48635) is a antibiotic antifungal drug (CHEBI:87113) |
| fumagillin (CHEBI:48635) is a carboxylic ester (CHEBI:33308) |
| fumagillin (CHEBI:48635) is a dicarboxylic acid monoester (CHEBI:36244) |
| fumagillin (CHEBI:48635) is a meroterpenoid (CHEBI:64419) |
| fumagillin (CHEBI:48635) is a organooxygen heterocyclic antibiotic (CHEBI:25807) |
| fumagillin (CHEBI:48635) is a spiro-epoxide (CHEBI:133131) |
| Incoming Relation(s) |
| fumagillin-2-yl group (CHEBI:42601) is substituent group from fumagillin (CHEBI:48635) |
| IUPAC Name |
|---|
| (2E,4E,6E,8E)-10-({(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-en-1-yl)oxiran-2-yl]-1-oxaspiro[2.5]oct-6-yl}oxy)-10-oxodeca-2,4,6,8-tetraenoic acid |
| INNs | Source |
|---|---|
| fumagilina | ChEBI |
| fumagilina | ChemIDplus |
| fumagilline | ChemIDplus |
| fumagillinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,4,6,8-decatetraenedioic acid, 4-(1,2-epoxy-1,5-dimethyl-4-hexenyl)-5-methoxy-1-oxaspiro(2,5)oct-6-yl ester | ChemIDplus |
| Fumagillin | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Fugillin | ChemIDplus |
| Fumidil | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3253 | DrugCentral |
| C00003133 | KNApSAcK |
| C09668 | KEGG COMPOUND |
| DB02640 | DrugBank |
| Fumagillin | Wikipedia |
| LMPR0103060003 | LIPID MAPS |
| US2652356 | Patent |
| US2803586 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5360220 | Reaxys |
| CAS:23110-15-8 | ChemIDplus |
| CAS:23110-15-8 | KEGG COMPOUND |
| Citations |
|---|