EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H41O3 |
| Net Charge | -1 |
| Average Mass | 353.567 |
| Monoisotopic Mass | 353.30612 |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCCC(O)C(=O)[O-] |
| InChI | InChI=1S/C22H42O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(23)22(24)25/h9-10,21,23H,2-8,11-20H2,1H3,(H,24,25)/p-1/b10-9- |
| InChIKey | VZMAFALCHHMPNA-KTKRTIGZSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyerucate (CHEBI:142988) has functional parent erucate (CHEBI:32393) |
| 2-hydroxyerucate (CHEBI:142988) is a 2-hydroxy fatty acid anion (CHEBI:76176) |
| 2-hydroxyerucate (CHEBI:142988) is a long-chain fatty acid anion (CHEBI:57560) |
| 2-hydroxyerucate (CHEBI:142988) is a monounsaturated fatty acid anion (CHEBI:82680) |
| 2-hydroxyerucate (CHEBI:142988) is conjugate base of 2-hydroxyerucic acid (CHEBI:143027) |
| Incoming Relation(s) |
| 2-hydroxyerucic acid (CHEBI:143027) is conjugate acid of 2-hydroxyerucate (CHEBI:142988) |
| IUPAC Name |
|---|
| (13Z)-2-hydroxydocos-13-enoate |
| Synonyms | Source |
|---|---|
| 2-hydroxy-(13Z)-docosenoate | SUBMITTER |
| 2-hydroxyerucic acid(1−) | ChEBI |