EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O2 |
| Net Charge | 0 |
| Average Mass | 170.252 |
| Monoisotopic Mass | 170.13068 |
| SMILES | C=CCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H18O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2H,1,3-9H2,(H,11,12) |
| InChIKey | KHAVLLBUVKBTBG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dec-9-enoic acid (CHEBI:32381) has role metabolite (CHEBI:25212) |
| dec-9-enoic acid (CHEBI:32381) is a decenoic acid (CHEBI:36003) |
| dec-9-enoic acid (CHEBI:32381) is conjugate acid of dec-9-enoate (CHEBI:33163) |
| Incoming Relation(s) |
| 9-decenoyl-CoA (CHEBI:85214) has functional parent dec-9-enoic acid (CHEBI:32381) |
| butyl dec-9-enoate (CHEBI:87291) has functional parent dec-9-enoic acid (CHEBI:32381) |
| ciliatamide A (CHEBI:65630) has functional parent dec-9-enoic acid (CHEBI:32381) |
| ethyl 9-decenoate (CHEBI:87338) has functional parent dec-9-enoic acid (CHEBI:32381) |
| dec-9-enoate (CHEBI:33163) is conjugate base of dec-9-enoic acid (CHEBI:32381) |
| IUPAC Name |
|---|
| dec-9-enoic acid |
| Synonyms | Source |
|---|---|
| 9-decenoic acid | ChemIDplus |
| Δ9-decenoic acid | ChEBI |
| caproleic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030033 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1756396 | Reaxys |
| CAS:14436-32-9 | ChemIDplus |
| Citations |
|---|