EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O2 |
| Net Charge | 0 |
| Average Mass | 198.306 |
| Monoisotopic Mass | 198.16198 |
| SMILES | C=CCCCCCCCC(=O)OCC |
| InChI | InChI=1S/C12H22O2/c1-3-5-6-7-8-9-10-11-12(13)14-4-2/h3H,1,4-11H2,2H3 |
| InChIKey | BKOJTZORTHALGP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 9-decenoate (CHEBI:87338) has functional parent dec-9-enoic acid (CHEBI:32381) |
| ethyl 9-decenoate (CHEBI:87338) has role metabolite (CHEBI:25212) |
| ethyl 9-decenoate (CHEBI:87338) is a fatty acid ethyl ester (CHEBI:78206) |
| IUPAC Name |
|---|
| ethyl dec-9-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1906615 | Reaxys |
| CAS:67233-91-4 | ChemIDplus |
| Citations |
|---|