EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H39N3O3 |
| Net Charge | 0 |
| Average Mass | 441.616 |
| Monoisotopic Mass | 441.29914 |
| SMILES | C=CCCCCCCCC(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@@H]1CCCCNC1=O |
| InChI | InChI=1S/C26H39N3O3/c1-3-4-5-6-7-8-12-18-24(30)29(2)23(20-21-15-10-9-11-16-21)26(32)28-22-17-13-14-19-27-25(22)31/h3,9-11,15-16,22-23H,1,4-8,12-14,17-20H2,2H3,(H,27,31)(H,28,32)/t22-,23-/m1/s1 |
| InChIKey | UNVIKJZRLTXMOH-DHIUTWEWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aaptos ciliata (WORMS:170732) | - | PubMed (18257536) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciliatamide A (CHEBI:65630) has functional parent dec-9-enoic acid (CHEBI:32381) |
| ciliatamide A (CHEBI:65630) has role antileishmanial agent (CHEBI:70868) |
| ciliatamide A (CHEBI:65630) has role metabolite (CHEBI:25212) |
| ciliatamide A (CHEBI:65630) is a caprolactams (CHEBI:23000) |
| ciliatamide A (CHEBI:65630) is a lipopeptide (CHEBI:46895) |
| IUPAC Name |
|---|
| N-methyl-N-[(2R)-1-oxo-1-{[(3R)-2-oxoazepan-3-yl]amino}-3-phenylpropan-2-yl]dec-9-enamide |
| Synonym | Source |
|---|---|
| (R,R)-ciliatamide A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19040133 | Reaxys |
| Citations |
|---|