EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2086 - 5-methoxy-N,N-dimethyltryptamine
| Formula | C13H18N2O |
| Net Charge | 0 |
| Average Mass | 218.300 |
| Monoisotopic Mass | 218.14191 |
| SMILES | COc1ccc2ncc(CCN(C)C)c2c1 |
| InChI | InChI=1S/C13H18N2O/c1-15(2)7-6-10-9-14-13-5-4-11(16-3)8-12(10)13/h4-5,8-9,14H,6-7H2,1-3H3 |
| InChIKey | ZSTKHSQDNIGFLM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | hallucinogen Drugs capable of inducing illusions, hallucinations, delusions, paranoid ideations and other alterations of mood and thinking. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methoxy-N,N-dimethyltryptamine (CHEBI:2086) has functional parent bufotenin (CHEBI:3210) |
| 5-methoxy-N,N-dimethyltryptamine (CHEBI:2086) has role hallucinogen (CHEBI:35499) |
| 5-methoxy-N,N-dimethyltryptamine (CHEBI:2086) has role plant metabolite (CHEBI:76924) |
| 5-methoxy-N,N-dimethyltryptamine (CHEBI:2086) is a aromatic ether (CHEBI:35618) |
| 5-methoxy-N,N-dimethyltryptamine (CHEBI:2086) is a tertiary amino compound (CHEBI:50996) |
| 5-methoxy-N,N-dimethyltryptamine (CHEBI:2086) is a tryptamine alkaloid (CHEBI:48274) |
| IUPAC Name |
|---|
| 2-(5-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine |
| Synonyms | Source |
|---|---|
| 5-Methoxy-N,N-dimethyltryptamine | KEGG COMPOUND |
| Indole, 3-(2-(N,N-dimethylamino)ethyl)-5-methoxy- | KEGG COMPOUND |
| N,N-dimethyl-5-methoxytryptamine | NIST Chemistry WebBook |
| O-methylbufotenine | ChemIDplus |
| 5-methoxy-N,N-dimethyl-1H-indole-3-ethanamine | ChemIDplus |
| MeODMT | ChemIDplus |
| Citations |
|---|