EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21O10 |
| Net Charge | +1 |
| Average Mass | 433.389 |
| Monoisotopic Mass | 433.11292 |
| SMILES | OC[C@H]1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H20O10/c22-8-16-17(26)18(27)19(28)21(31-16)30-15-7-12-13(25)5-11(24)6-14(12)29-20(15)9-1-3-10(23)4-2-9/h1-7,16-19,21-22,26-28H,8H2,(H2-,23,24,25)/p+1/t16-,17-,18+,19-,21-/m1/s1 |
| InChIKey | ABVCUBUIXWJYSE-GQUPQBGVSA-O |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pelargonidin 3-O-β-D-glucoside (CHEBI:31967) has functional parent pelargonidin (CHEBI:25863) |
| pelargonidin 3-O-β-D-glucoside (CHEBI:31967) has role plant metabolite (CHEBI:76924) |
| pelargonidin 3-O-β-D-glucoside (CHEBI:31967) is a anthocyanidin glycoside (CHEBI:71583) |
| pelargonidin 3-O-β-D-glucoside (CHEBI:31967) is a β-D-glucoside (CHEBI:22798) |
| pelargonidin 3-O-β-D-glucoside (CHEBI:31967) is conjugate acid of pelargonidin 3-O-β-D-glucoside betaine (CHEBI:144778) |
| Incoming Relation(s) |
| pelargonidin 3-(6-p-coumaroyl)glucoside (CHEBI:80475) has functional parent pelargonidin 3-O-β-D-glucoside (CHEBI:31967) |
| pelargonidin 3-O-β-D-glucoside chloride (CHEBI:36122) has part pelargonidin 3-O-β-D-glucoside (CHEBI:31967) |
| pelargonidin 3-O-β-D-glucoside betaine (CHEBI:144778) is conjugate base of pelargonidin 3-O-β-D-glucoside (CHEBI:31967) |
| IUPAC Name |
|---|
| 3-(β-D-glucopyranosyloxy)-5,7-dihydroxy-4'-hydroxyflavylium |
| Synonyms | Source |
|---|---|
| Pelargonidin 3-O-glucoside | KEGG COMPOUND |
| Pelargonidin 3-glucoside | KEGG COMPOUND |
| Pelargonidin-3-glucoside | ChemIDplus |
| Pelargonidin-3-glucopyranoside | ChemIDplus |
| 3-(beta-D-Glucopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium chloride | ChemIDplus |
| 3-(β-D-glucopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)chromenylium chloride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C12137 | KEGG COMPOUND |
| PELARGONIDIN-3-GLUCOSIDE-CMPD | MetaCyc |
| LMPK12010016 | LIPID MAPS |
| Callistephin | Wikipedia |
| C00006630 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3919123 | Beilstein |
| Beilstein:1672351 | Beilstein |
| Reaxys:3901091 | Reaxys |
| CAS:18466-51-8 | KEGG COMPOUND |
| CAS:18466-51-8 | ChemIDplus |
| Citations |
|---|