EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11O5 |
| Net Charge | +1 |
| Average Mass | 271.248 |
| Monoisotopic Mass | 271.06010 |
| SMILES | Oc1ccc(-c2[o+]c3cc(O)cc(O)c3cc2O)cc1 |
| InChI | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15/h1-7H,(H3-,16,17,18,19)/p+1 |
| InChIKey | XVFMGWDSJLBXDZ-UHFFFAOYSA-O |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pelargonidin (CHEBI:25863) has role plant metabolite (CHEBI:76924) |
| pelargonidin (CHEBI:25863) is a 5-hydroxyanthocyanidin (CHEBI:140277) |
| pelargonidin (CHEBI:25863) is conjugate acid of pelargonidin(1−) (CHEBI:144777) |
| Incoming Relation(s) |
| 4'''-demalonylsalvianin (CHEBI:31121) has functional parent pelargonidin (CHEBI:25863) |
| monardaein (CHEBI:6972) has functional parent pelargonidin (CHEBI:25863) |
| pelargonidin 3-O-(6-O-caffeoyl-β-D-glucoside) 5-O-β-D-glucoside (CHEBI:31966) has functional parent pelargonidin (CHEBI:25863) |
| pelargonidin 3-O-(6-O-malonyl-β-D-glucoside) (CHEBI:31965) has functional parent pelargonidin (CHEBI:25863) |
| pelargonidin 3-O-sophoroside (CHEBI:134007) has functional parent pelargonidin (CHEBI:25863) |
| pelargonidin 3-O-β-D-glucoside (CHEBI:31967) has functional parent pelargonidin (CHEBI:25863) |
| pelargonidin 3-O-β-D-sambubioside (CHEBI:74809) has functional parent pelargonidin (CHEBI:25863) |
| pelargonin (CHEBI:133365) has functional parent pelargonidin (CHEBI:25863) |
| salvianin (CHEBI:32115) has functional parent pelargonidin (CHEBI:25863) |
| pelargonidin chloride (CHEBI:28510) has part pelargonidin (CHEBI:25863) |
| pelargonidin(1−) (CHEBI:144777) is conjugate base of pelargonidin (CHEBI:25863) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-(4-hydroxyphenyl)chromenylium |
| Synonyms | Source |
|---|---|
| 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium | ChemIDplus |
| pelargonidin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00007232 | KNApSAcK |
| C05904 | KEGG COMPOUND |
| LMPK12010003 | LIPID MAPS |
| Pelargonidin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1688614 | Reaxys |
| CAS:134-04-3 | KEGG COMPOUND |
| CAS:7690-51-9 | ChemIDplus |
| Citations |
|---|