EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:80475 - pelargonidin 3-(6-p-coumaroyl)glucoside
| Formula | C30H27O12 |
| Net Charge | +1 |
| Average Mass | 579.534 |
| Monoisotopic Mass | 579.14970 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)OC[C@H]1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H26O12/c31-17-6-1-15(2-7-17)3-10-25(35)39-14-24-26(36)27(37)28(38)30(42-24)41-23-13-20-21(34)11-19(33)12-22(20)40-29(23)16-4-8-18(32)9-5-16/h1-13,24,26-28,30,36-38H,14H2,(H3-,31,32,33,34,35)/p+1/t24-,26-,27+,28-,30-/m1/s1 |
| InChIKey | VZPBBOAZFCREMQ-SHPGVJHPSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pelargonidin 3-(6-p-coumaroyl)glucoside (CHEBI:80475) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| pelargonidin 3-(6-p-coumaroyl)glucoside (CHEBI:80475) has functional parent pelargonidin 3-O-β-D-glucoside (CHEBI:31967) |
| pelargonidin 3-(6-p-coumaroyl)glucoside (CHEBI:80475) has role plant metabolite (CHEBI:76924) |
| pelargonidin 3-(6-p-coumaroyl)glucoside (CHEBI:80475) is a anthocyanidin glycoside (CHEBI:71583) |
| pelargonidin 3-(6-p-coumaroyl)glucoside (CHEBI:80475) is a cinnamate ester (CHEBI:36087) |
| pelargonidin 3-(6-p-coumaroyl)glucoside (CHEBI:80475) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-1-benzopyran-1-ium-3-yl 6-O-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-β-D-glucopyranoside |