EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H40BrN5O5.CH4O3S |
| Net Charge | 0 |
| Average Mass | 750.713 |
| Monoisotopic Mass | 749.20940 |
| SMILES | CS(=O)(=O)O.[H][C@@]12Cc3c(Br)nc4cccc(c34)C1=C[C@@H](C(=O)N[C@]1(C(C)C)O[C@]3(O)N(C1=O)[C@@H](CC(C)C)C(=O)N1CCC[C@]13[H])CN2C |
| InChI | InChI=1S/C32H40BrN5O5.CH4O3S/c1-16(2)12-24-29(40)37-11-7-10-25(37)32(42)38(24)30(41)31(43-32,17(3)4)35-28(39)18-13-20-19-8-6-9-22-26(19)21(27(33)34-22)14-23(20)36(5)15-18;1-5(2,3)4/h6,8-9,13,16-18,23-25,34,42H,7,10-12,14-15H2,1-5H3,(H,35,39);1H3,(H,2,3,4)/t18-,23-,24+,25+,31-,32+;/m1./s1 |
| InChIKey | NOJMTMIRQRDZMT-GSPXQYRGSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiparkinson drug A drug used in the treatment of Parkinson's disease. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromocriptine methanesulfonate (CHEBI:3182) has part bromocriptine (CHEBI:3181) |
| bromocriptine methanesulfonate (CHEBI:3182) has role antineoplastic agent (CHEBI:35610) |
| bromocriptine methanesulfonate (CHEBI:3182) has role antiparkinson drug (CHEBI:48407) |
| bromocriptine methanesulfonate (CHEBI:3182) has role hypoglycemic agent (CHEBI:35526) |
| bromocriptine methanesulfonate (CHEBI:3182) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| (5'α)-2-bromo-12'-hydroxy-5'-(2-methylpropyl)-2'-(propan-2-yl)-3',6',18-trioxoergotaman methanesulfonate |
| Synonyms | Source |
|---|---|
| 2-bromoergocryptine mesylate | ChEMBL |
| 2-bromo-α-ergocryptine mesylate | ChemIDplus |
| (5'α)-2-bromo-12'-hydroxy-5'-isobutyl-2'-isopropyl-3',6',18-trioxoergotaman methanesulfonate | IUPAC |
| bromocriptine mesilate | KEGG DRUG |
| bromocriptine mesylate | ChEMBL |
| bromocriptine mesylate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Cycloset | ChEMBL |
| Parlodel | KEGG DRUG |
| Pravidel | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D00780 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6048116 | Beilstein |
| CAS:22260-51-1 | ChemIDplus |
| Citations |
|---|