EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20NOS |
| Net Charge | +1 |
| Average Mass | 310.442 |
| Monoisotopic Mass | 310.12601 |
| SMILES | C[NH+]1CCC(=C2c3ccccc3CC(=O)c3sccc32)CC1 |
| InChI | InChI=1S/C19H19NOS/c1-20-9-6-13(7-10-20)18-15-5-3-2-4-14(15)12-17(21)19-16(18)8-11-22-19/h2-5,8,11H,6-7,9-10,12H2,1H3/p+1 |
| InChIKey | ZCVMWBYGMWKGHF-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ketotifen(1+) (CHEBI:140417) is a ammonium ion derivative (CHEBI:35274) |
| ketotifen(1+) (CHEBI:140417) is conjugate acid of ketotifen (CHEBI:92511) |
| Incoming Relation(s) |
| ketotifen fumarate (CHEBI:31750) has part ketotifen(1+) (CHEBI:140417) |
| ketotifen (CHEBI:92511) is conjugate base of ketotifen(1+) (CHEBI:140417) |
| IUPAC Name |
|---|
| 1-methyl-4-(10-oxo-9,10-dihydro-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-ylidene)piperidinium |