EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32NO9 |
| Net Charge | +1 |
| Average Mass | 514.551 |
| Monoisotopic Mass | 514.20716 |
| SMILES | CC[C@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](O[C@H]2C[C@H]([NH3+])[C@H](O)[C@H](C)O2)C1)C(=O)c1c(OC)cccc1C3=O |
| InChI | InChI=1S/C27H31NO9/c1-4-27(34)9-13-19(16(10-27)37-17-8-14(28)22(29)11(2)36-17)26(33)21-20(24(13)31)23(30)12-6-5-7-15(35-3)18(12)25(21)32/h5-7,11,14,16-17,22,29,31,33-34H,4,8-10,28H2,1-3H3/p+1/t11-,14-,16-,17-,22+,27-/m0/s1 |
| InChIKey | XAMIMZAWZUSOPA-JIGXQNLBSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-deoxydaunorubicin(1+) (CHEBI:75297) is a ammonium ion derivative (CHEBI:35274) |
| 13-deoxydaunorubicin(1+) (CHEBI:75297) is a organic cation (CHEBI:25697) |
| 13-deoxydaunorubicin(1+) (CHEBI:75297) is conjugate acid of 13-deoxydaunorubicin (CHEBI:31057) |
| Incoming Relation(s) |
| 13-deoxydaunorubicin (CHEBI:31057) is conjugate base of 13-deoxydaunorubicin(1+) (CHEBI:75297) |
| IUPAC Name |
|---|
| (1S,3S)-3-ethyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-azaniumyl-2,3,6-trideoxy-α-L-lyxo-hexopyranoside |
| UniProt Name | Source |
|---|---|
| 13-deoxydaunorubicin | UniProt |
| Citations |
|---|