EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18FN3O3.2HCl |
| Net Charge | 0 |
| Average Mass | 404.269 |
| Monoisotopic Mass | 403.08658 |
| SMILES | Cl.Cl.O=C(O)c1cn(C2CC2)c2cc(N3CCNCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C17H18FN3O3.2ClH/c18-13-7-11-14(8-15(13)20-5-3-19-4-6-20)21(10-1-2-10)9-12(16(11)22)17(23)24;;/h7-10,19H,1-6H2,(H,23,24);2*1H |
| InChIKey | PWRKLYZVCZMDTC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciprofloxacin dihydrochloride (CHEBI:59938) has part ciprofloxacin hydrochloride (anhydrous) (CHEBI:310388) |
| ciprofloxacin dihydrochloride (CHEBI:59938) has role antibacterial drug (CHEBI:36047) |
| ciprofloxacin dihydrochloride (CHEBI:59938) has role antiinfective agent (CHEBI:35441) |
| ciprofloxacin dihydrochloride (CHEBI:59938) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| ciprofloxacin dihydrochloride (CHEBI:59938) has role topoisomerase IV inhibitor (CHEBI:53559) |
| ciprofloxacin dihydrochloride (CHEBI:59938) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-cyclopropyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid dihydrochloride |
| Synonym | Source |
|---|---|
| 1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid dihydrochloride | ChEBI |