EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H29N2O3.Cl |
| Net Charge | 0 |
| Average Mass | 344.883 |
| Monoisotopic Mass | 344.18667 |
| SMILES | CCCCOc1cc(C(=O)OCC[NH+](CC)CC)ccc1N.[Cl-] |
| InChI | InChI=1S/C17H28N2O3.ClH/c1-4-7-11-21-16-13-14(8-9-15(16)18)17(20)22-12-10-19(5-2)6-3;/h8-9,13H,4-7,10-12,18H2,1-3H3;1H |
| InChIKey | PRGUDWLMFLCODA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxybuprocaine hydrochloride (CHEBI:31260) has part oxybuprocaine (CHEBI:309594) |
| oxybuprocaine hydrochloride (CHEBI:31260) has role local anaesthetic (CHEBI:36333) |
| oxybuprocaine hydrochloride (CHEBI:31260) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 2-[(4-amino-3-butoxybenzoyl)oxy]-N,N-diethylethanaminium chloride |
| 2-(diethylamino)ethyl 4-amino-3-butoxybenzoate hydrochloride |
| Synonyms | Source |
|---|---|
| benoxinate HCl | ChemIDplus |
| oxybuprocaine HCl | ChEBI |
| oxybuprocaine monohydrochloride | ChEBI |
| benoxinate monohydrochloride | ChEBI |
| Brand Names | Source |
|---|---|
| Novesin | DrugBank |
| Benoxil | DrugBank |
| Conjuncain | DrugBank |
| Novesina | DrugBank |
| Cebesine | DrugBank |
| Novesine | DrugBank |