EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@]12C(=O)C=C3[C@]4([H])C[C@@](C)(C(=O)O)CC[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H46O4/c1-25(2)21-8-11-30(7)23(28(21,5)10-9-22(25)32)20(31)16-18-19-17-27(4,24(33)34)13-12-26(19,3)14-15-29(18,30)6/h16,19,21-23,32H,8-15,17H2,1-7H3,(H,33,34)/t19-,21-,22-,23+,26+,27-,28-,29+,30+/m0/s1 |
| InChIKey | MPDGHEJMBKOTSU-YKLVYJNSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycyrrhetinic acid (CHEBI:30853) has parent hydride oleanane (CHEBI:36481) |
| glycyrrhetinic acid (CHEBI:30853) has role immunomodulator (CHEBI:50846) |
| glycyrrhetinic acid (CHEBI:30853) has role plant metabolite (CHEBI:76924) |
| glycyrrhetinic acid (CHEBI:30853) is a cyclic terpene ketone (CHEBI:36130) |
| glycyrrhetinic acid (CHEBI:30853) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| glycyrrhetinic acid (CHEBI:30853) is a pentacyclic triterpenoid (CHEBI:25872) |
| glycyrrhetinic acid (CHEBI:30853) is conjugate acid of glycyrrhetinate (CHEBI:17573) |
| Incoming Relation(s) |
| 3-oxoglycyrrhetinic acid (CHEBI:16404) has functional parent glycyrrhetinic acid (CHEBI:30853) |
| 3α-hydroxyglycyrrhetinic acid (CHEBI:16317) has functional parent glycyrrhetinic acid (CHEBI:30853) |
| glycyrrhetic acid 3-O-glucuronide (CHEBI:189708) has functional parent glycyrrhetinic acid (CHEBI:30853) |
| glycyrrhetinate (CHEBI:17573) is conjugate base of glycyrrhetinic acid (CHEBI:30853) |
| IUPAC Name |
|---|
| 3β-hydroxy-11-oxoolean-12-en-30-oic acid |
| Synonyms | Source |
|---|---|
| 18β-glycyrrhetic acid | ChemIDplus |
| Enoxolone | KEGG COMPOUND |
| Glycyrrhetinic acid | KEGG COMPOUND |
| Citations |
|---|