EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30853 - glycyrrhetinic acid
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@]12C(=O)C=C3[C@]4([H])C[C@@](C)(C(=O)O)CC[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H46O4/c1-25(2)21-8-11-30(7)23(28(21,5)10-9-22(25)32)20(31)16-18-19-17-27(4,24(33)34)13-12-26(19,3)14-15-29(18,30)6/h16,19,21-23,32H,8-15,17H2,1-7H3,(H,33,34)/t19-,21-,22-,23+,26+,27-,28-,29+,30+/m0/s1 |
| InChIKey | MPDGHEJMBKOTSU-YKLVYJNSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycyrrhetinic acid (CHEBI:30853) has parent hydride oleanane (CHEBI:36481) |
| glycyrrhetinic acid (CHEBI:30853) has role anti-ulcer drug (CHEBI:49201) |
| glycyrrhetinic acid (CHEBI:30853) has role antidepressant (CHEBI:35469) |
| glycyrrhetinic acid (CHEBI:30853) has role immunomodulator (CHEBI:50846) |
| glycyrrhetinic acid (CHEBI:30853) has role plant metabolite (CHEBI:76924) |
| glycyrrhetinic acid (CHEBI:30853) is a cyclic terpene ketone (CHEBI:36130) |
| glycyrrhetinic acid (CHEBI:30853) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| glycyrrhetinic acid (CHEBI:30853) is a pentacyclic triterpenoid (CHEBI:25872) |
| glycyrrhetinic acid (CHEBI:30853) is conjugate acid of glycyrrhetinate (CHEBI:17573) |
| Incoming Relation(s) |
| 3-oxoglycyrrhetinic acid (CHEBI:16404) has functional parent glycyrrhetinic acid (CHEBI:30853) |
| 3α-hydroxyglycyrrhetinic acid (CHEBI:16317) has functional parent glycyrrhetinic acid (CHEBI:30853) |
| glycyrrhetic acid 3-O-glucuronide (CHEBI:189708) has functional parent glycyrrhetinic acid (CHEBI:30853) |
| glycyrrhetinate (CHEBI:17573) is conjugate base of glycyrrhetinic acid (CHEBI:30853) |
| IUPAC Name |
|---|
| 3β-hydroxy-11-oxoolean-12-en-30-oic acid |
| INN | Source |
|---|---|
| enoxolona | WHO MedNet |
| Synonyms | Source |
|---|---|
| 18β-glycyrrhetic acid | ChemIDplus |
| enoxolone | ChEMBL |
| Enoxolone | KEGG COMPOUND |
| Glycyrrhetinic acid | KEGG COMPOUND |
| NSC-35347 | ChEMBL |
| NSC-35350 | ChEMBL |
| Citations |
|---|