EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H54O10 |
| Net Charge | 0 |
| Average Mass | 646.818 |
| Monoisotopic Mass | 646.37170 |
| SMILES | [H][C@]12C(=O)C=C3[C@]4([H])C[C@@](C)(C(=O)O)CC[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)CC[C@]21C |
| InChI | InChI=1S/C36H54O10/c1-31(2)21-8-11-36(7)27(34(21,5)10-9-22(31)45-29-25(40)23(38)24(39)26(46-29)28(41)42)20(37)16-18-19-17-33(4,30(43)44)13-12-32(19,3)14-15-35(18,36)6/h16,19,21-27,29,38-40H,8-15,17H2,1-7H3,(H,41,42)(H,43,44)/t19-,21-,22-,23-,24-,25+,26-,27+,29+,32+,33-,34-,35+,36+/m0/s1 |
| InChIKey | HLDYLAJAWSKPFZ-QDPIGISRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza (ncbitaxon:46347) | Root (BTO:0001188) | DOI (10.1016/j.synbio.2021.07.001) |
| Roles Classification |
|---|
| Chemical Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 1.1.1.146 (11beta-hydroxysteroid dehydrogenase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of 11β-hydroxysteroid dehydrogenase (EC 1.1.1.146). sweetening agent Substance that sweeten food, beverages, medications, etc. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycyrrhetic acid 3-O-glucuronide (CHEBI:189708) has functional parent glycyrrhetinic acid (CHEBI:30853) |
| glycyrrhetic acid 3-O-glucuronide (CHEBI:189708) has role anti-allergic agent (CHEBI:50857) |
| glycyrrhetic acid 3-O-glucuronide (CHEBI:189708) has role EC 1.1.1.146 (11β-hydroxysteroid dehydrogenase) inhibitor (CHEBI:137626) |
| glycyrrhetic acid 3-O-glucuronide (CHEBI:189708) has role human xenobiotic metabolite (CHEBI:76967) |
| glycyrrhetic acid 3-O-glucuronide (CHEBI:189708) has role plant metabolite (CHEBI:76924) |
| glycyrrhetic acid 3-O-glucuronide (CHEBI:189708) has role sweetening agent (CHEBI:50505) |
| glycyrrhetic acid 3-O-glucuronide (CHEBI:189708) is a enone (CHEBI:51689) |
| glycyrrhetic acid 3-O-glucuronide (CHEBI:189708) is a monosaccharide derivative (CHEBI:63367) |
| glycyrrhetic acid 3-O-glucuronide (CHEBI:189708) is a oxo dicarboxylic acid (CHEBI:36145) |
| glycyrrhetic acid 3-O-glucuronide (CHEBI:189708) is a pentacyclic triterpenoid (CHEBI:25872) |
| glycyrrhetic acid 3-O-glucuronide (CHEBI:189708) is a triterpenoid saponin (CHEBI:61778) |
| glycyrrhetic acid 3-O-glucuronide (CHEBI:189708) is a β-D-glucosiduronic acid (CHEBI:15341) |
| IUPAC Name |
|---|
| 30-hydroxy-11,30-dioxoolean-12-en-3β-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| 18β-glycyrrhetinic acid-3-O-β-D-glucuronide | ChEBI |
| 18β-glycyrrhetyl-3-O-glucuronide | ChEBI |
| 3-O-glucuronopyranosylglycyrrhetinic acid | ChEBI |
| 3-O-β-D-glucuronopyranosyl-18β-glycyrrhetinic acid | ChEBI |
| 3-MGA | ChemIDplus |
| 3MGA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 142103 | ChemSpider |
| CN1789413 | Patent |
| FDB016976 | FooDB |
| FJL | PDBeChem |
| HMDB0037827 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:34096-83-8 | ChemIDplus |
| Citations |
|---|