EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H45O4 |
| Net Charge | -1 |
| Average Mass | 469.686 |
| Monoisotopic Mass | 469.33233 |
| SMILES | [H][C@]12C(=O)C=C3[C@]4([H])C[C@@](C)(C(=O)[O-])CC[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H46O4/c1-25(2)21-8-11-30(7)23(28(21,5)10-9-22(25)32)20(31)16-18-19-17-27(4,24(33)34)13-12-26(19,3)14-15-29(18,30)6/h16,19,21-23,32H,8-15,17H2,1-7H3,(H,33,34)/p-1/t19-,21-,22-,23+,26+,27-,28-,29+,30+/m0/s1 |
| InChIKey | MPDGHEJMBKOTSU-YKLVYJNSSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycyrrhetinate (CHEBI:17573) is a monocarboxylic acid anion (CHEBI:35757) |
| glycyrrhetinate (CHEBI:17573) is conjugate base of glycyrrhetinic acid (CHEBI:30853) |
| Incoming Relation(s) |
| glycyrrhetinic acid (CHEBI:30853) is conjugate acid of glycyrrhetinate (CHEBI:17573) |
| IUPAC Name |
|---|
| 3β-hydroxy-11-oxoolean-12-en-30-oate |
| Synonym | Source |
|---|---|
| Glycyrrhetinate | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| glycyrrhetinate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02283 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:1449-05-4 | KEGG COMPOUND |
| CAS:471-53-4 | KEGG COMPOUND |