EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O3 |
| Net Charge | 0 |
| Average Mass | 104.105 |
| Monoisotopic Mass | 104.04734 |
| SMILES | O=C(O)CCCO |
| InChI | InChI=1S/C4H8O3/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7) |
| InChIKey | SJZRECIVHVDYJC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | neurotoxin A poison that interferes with the functions of the nervous system. GHB receptor agonist A drug that binds to and activates γ-hydroxybutyric acid receptors. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. GHB receptor agonist A drug that binds to and activates γ-hydroxybutyric acid receptors. general anaesthetic Substance that produces loss of consciousness. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxybutyric acid (CHEBI:30830) has functional parent butyric acid (CHEBI:30772) |
| 4-hydroxybutyric acid (CHEBI:30830) has role general anaesthetic (CHEBI:38869) |
| 4-hydroxybutyric acid (CHEBI:30830) has role GHB receptor agonist (CHEBI:53353) |
| 4-hydroxybutyric acid (CHEBI:30830) has role neurotoxin (CHEBI:50910) |
| 4-hydroxybutyric acid (CHEBI:30830) has role sedative (CHEBI:35717) |
| 4-hydroxybutyric acid (CHEBI:30830) is a 4-hydroxy monocarboxylic acid (CHEBI:35970) |
| 4-hydroxybutyric acid (CHEBI:30830) is a hydroxybutyric acid (CHEBI:24684) |
| 4-hydroxybutyric acid (CHEBI:30830) is conjugate acid of 4-hydroxybutyrate (CHEBI:16724) |
| Incoming Relation(s) |
| 4-hydroxybutyryl-CoA (CHEBI:28522) has functional parent 4-hydroxybutyric acid (CHEBI:30830) |
| mono(3-carboxypropyl) phthalate (CHEBI:132872) has functional parent 4-hydroxybutyric acid (CHEBI:30830) |
| 4-hydroxybutyrate (CHEBI:16724) is conjugate base of 4-hydroxybutyric acid (CHEBI:30830) |
| IUPAC Name |
|---|
| 4-hydroxybutanoic acid |
| Synonyms | Source |
|---|---|
| 3-carboxypropoxy acid | ChEBI |
| 4-Hydroxyalkanoic acid | KEGG COMPOUND |
| 4-Hydroxybutanoate | KEGG COMPOUND |
| 4-Hydroxybutanoic acid | KEGG COMPOUND |
| 4-hydroxy-butyric acid | LIPID MAPS |
| 4-Hydroxybutyric acid | KEGG COMPOUND |
| Citations |
|---|