EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16724 - 4-hydroxybutyrate
| Formula | C4H7O3 |
| Net Charge | -1 |
| Average Mass | 103.097 |
| Monoisotopic Mass | 103.04007 |
| SMILES | O=C([O-])CCCO |
| InChI | InChI=1S/C4H8O3/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7)/p-1 |
| InChIKey | SJZRECIVHVDYJC-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | anaesthesia adjuvant Any substance that possesses little anaesthetic effect by itself, but which enhances or potentiates the anaesthetic action of other drugs when given at the same time. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxybutyrate (CHEBI:16724) has functional parent butyrate (CHEBI:17968) |
| 4-hydroxybutyrate (CHEBI:16724) has role anaesthesia adjuvant (CHEBI:60807) |
| 4-hydroxybutyrate (CHEBI:16724) has role intravenous anaesthetic (CHEBI:38877) |
| 4-hydroxybutyrate (CHEBI:16724) is a 4-hydroxy monocarboxylic acid anion (CHEBI:136596) |
| 4-hydroxybutyrate (CHEBI:16724) is a hydroxy fatty acid anion (CHEBI:59835) |
| 4-hydroxybutyrate (CHEBI:16724) is a short-chain fatty acid anion (CHEBI:58951) |
| 4-hydroxybutyrate (CHEBI:16724) is conjugate base of 4-hydroxybutyric acid (CHEBI:30830) |
| Incoming Relation(s) |
| 4-hydroxybutyric acid (CHEBI:30830) is conjugate acid of 4-hydroxybutyrate (CHEBI:16724) |
| IUPAC Name |
|---|
| 4-hydroxybutanoate |
| Synonyms | Source |
|---|---|
| GHB | ChemIDplus |
| γ-hydroxybutyrate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 4-hydroxybutanoate | UniProt |