EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O6 |
| Net Charge | 0 |
| Average Mass | 252.222 |
| Monoisotopic Mass | 252.06339 |
| SMILES | O=C(O)CCCOC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C12H12O6/c13-10(14)6-3-7-18-12(17)9-5-2-1-4-8(9)11(15)16/h1-2,4-5H,3,6-7H2,(H,13,14)(H,15,16) |
| InChIKey | IYTPMLIWBZMBSL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mono(3-carboxypropyl) phthalate (CHEBI:132872) has functional parent 4-hydroxybutyric acid (CHEBI:30830) |
| mono(3-carboxypropyl) phthalate (CHEBI:132872) has role human urinary metabolite (CHEBI:84087) |
| mono(3-carboxypropyl) phthalate (CHEBI:132872) has role human xenobiotic metabolite (CHEBI:76967) |
| mono(3-carboxypropyl) phthalate (CHEBI:132872) is a dicarboxylic acid (CHEBI:35692) |
| mono(3-carboxypropyl) phthalate (CHEBI:132872) is a phthalic acid monoester (CHEBI:132610) |
| IUPAC Name |
|---|
| 2-[(3-carboxypropoxy)carbonyl]benzoic acid |
| Synonyms | Source |
|---|---|
| mono-(3-carboxypropyl) phthalate | ChEBI |
| mono-3-carboxypropyl phthalate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11280114 | Reaxys |
| Citations |
|---|