EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29NO3 |
| Net Charge | 0 |
| Average Mass | 307.434 |
| Monoisotopic Mass | 307.21474 |
| SMILES | CC(C)NCC(O)COc1ccc(CCOCC2CC2)cc1 |
| InChI | InChI=1S/C18H29NO3/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3 |
| InChIKey | NWIUTZDMDHAVTP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| Applications: | sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| betaxolol (CHEBI:3082) has role antiglaucoma drug (CHEBI:39456) |
| betaxolol (CHEBI:3082) has role antihypertensive agent (CHEBI:35674) |
| betaxolol (CHEBI:3082) has role cardiovascular drug (CHEBI:35554) |
| betaxolol (CHEBI:3082) has role sympatholytic agent (CHEBI:66991) |
| betaxolol (CHEBI:3082) has role β-adrenergic antagonist (CHEBI:35530) |
| betaxolol (CHEBI:3082) is a propanolamine (CHEBI:35533) |
| Incoming Relation(s) |
| betaxolol hydrochloride (CHEBI:643228) has part betaxolol (CHEBI:3082) |
| (R)-betaxolol (CHEBI:59251) is a betaxolol (CHEBI:3082) |
| (S)-betaxolol (CHEBI:59254) is a betaxolol (CHEBI:3082) |
| IUPAC Name |
|---|
| 1-{4-[2-(cyclopropylmethoxy)ethyl]phenoxy}-3-(propan-2-ylamino)propan-2-ol |
| INNs | Source |
|---|---|
| betaxolol | WHO MedNet |
| betaxolol | ChemIDplus |
| bétaxolol | WHO MedNet |
| betaxololum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(4-(2-(cyclopropylmethoxy)ethyl)phenoxy)-3-((1-methylethyl)amino)-2-propanol | ChemIDplus |
| 1-(isopropylamino)-3-[p-(cyclopropylmethoxyethyl)phenoxy]-2-propanol | ChEBI |
| ALO-140102 FREE BASE | ChEMBL |
| Kerledex | ChEMBL |
| SL-7521210 FREE BASE | ChEMBL |
| Brand Names | Source |
|---|---|
| Betoptic | ChEMBL |
| Betoptic susp | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1991268 | Reaxys |
| CAS:63659-18-7 | ChemIDplus |
| CAS:63659-18-7 | KEGG COMPOUND |
| Citations |
|---|