EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59254 - (S)-betaxolol
| Formula | C18H29NO3 |
| Net Charge | 0 |
| Average Mass | 307.434 |
| Monoisotopic Mass | 307.21474 |
| SMILES | CC(C)NC[C@H](O)COc1ccc(CCOCC2CC2)cc1 |
| InChI | InChI=1S/C18H29NO3/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | NWIUTZDMDHAVTP-KRWDZBQOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| Applications: | antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-betaxolol (CHEBI:59254) is a alcohol (CHEBI:30879) |
| (S)-betaxolol (CHEBI:59254) is a betaxolol (CHEBI:3082) |
| (S)-betaxolol (CHEBI:59254) is a organic molecular entity (CHEBI:50860) |
| (S)-betaxolol (CHEBI:59254) is a phenols (CHEBI:33853) |
| (S)-betaxolol (CHEBI:59254) is enantiomer of (R)-betaxolol (CHEBI:59251) |
| Incoming Relation(s) |
| (R)-betaxolol (CHEBI:59251) is enantiomer of (S)-betaxolol (CHEBI:59254) |
| IUPAC Name |
|---|
| (2S)-1-{4-[2-(cyclopropylmethoxy)ethyl]phenoxy}-3-(propan-2-ylamino)propan-2-ol |
| INNs | Source |
|---|---|
| levobetaxolol | WHO MedNet |
| levobetaxolol | WHO MedNet |
| lévobétaxolol | WHO MedNet |
| levobetaxololum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (−)-betaxolol | ChEBI |
| Betaxolol, (s)- | ChEMBL |
| (S)-1-(isopropylamino)-3-[p-(cyclopropylmethoxyethyl)phenoxy]-2-propanol | ChEBI |
| (S)-(−)-betaxolol | ChEBI |
| levobetaxolol | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4752 | DrugCentral |
| DB00195 | DrugBank |
| Levobetaxolol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6064196 | Reaxys |
| Citations |
|---|