EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59254 - (S)-betaxolol
| Formula | C18H29NO3 |
| Net Charge | 0 |
| Average Mass | 307.434 |
| Monoisotopic Mass | 307.21474 |
| SMILES | CC(C)NC[C@H](O)COc1ccc(CCOCC2CC2)cc1 |
| InChI | InChI=1S/C18H29NO3/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | NWIUTZDMDHAVTP-KRWDZBQOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). |
| Applications: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-betaxolol (CHEBI:59254) is a betaxolol (CHEBI:3082) |
| (S)-betaxolol (CHEBI:59254) is enantiomer of (R)-betaxolol (CHEBI:59251) |
| Incoming Relation(s) |
| (R)-betaxolol (CHEBI:59251) is enantiomer of (S)-betaxolol (CHEBI:59254) |
| IUPAC Name |
|---|
| (2S)-1-{4-[2-(cyclopropylmethoxy)ethyl]phenoxy}-3-(propan-2-ylamino)propan-2-ol |
| INNs | Source |
|---|---|
| levobetaxolol | WHO MedNet |
| levobetaxolol | WHO MedNet |
| levobetaxololum | WHO MedNet |
| lévobétaxolol | WHO MedNet |
| Synonyms | Source |
|---|---|
| (S)-1-(isopropylamino)-3-[p-(cyclopropylmethoxyethyl)phenoxy]-2-propanol | ChEBI |
| (−)-betaxolol | ChEBI |
| (S)-(−)-betaxolol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB00195 | DrugBank |
| Levobetaxolol | Wikipedia |
| 4752 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6064196 | Reaxys |
| Citations |
|---|