EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:643228 - betaxolol hydrochloride
| Formula | C18H30NO3.Cl |
| Net Charge | 0 |
| Average Mass | 343.895 |
| Monoisotopic Mass | 343.19142 |
| SMILES | CC(C)[NH2+]CC(O)COc1ccc(CCOCC2CC2)cc1.[Cl-] |
| InChI | InChI=1S/C18H29NO3.ClH/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16;/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3;1H |
| InChIKey | CHDPSNLJFOQTRK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| Applications: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| betaxolol hydrochloride (CHEBI:643228) has part betaxolol (CHEBI:3082) |
| betaxolol hydrochloride (CHEBI:643228) has role antihypertensive agent (CHEBI:35674) |
| betaxolol hydrochloride (CHEBI:643228) has role β-adrenergic antagonist (CHEBI:35530) |
| betaxolol hydrochloride (CHEBI:643228) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| (R)-betaxolol hydrochloride (CHEBI:59255) is a betaxolol hydrochloride (CHEBI:643228) |
| (S)-betaxolol hydrochloride (CHEBI:59256) is a betaxolol hydrochloride (CHEBI:643228) |
| IUPAC Name |
|---|
| 1-{4-[2-(cyclopropylmethoxy)ethyl]phenoxy}-3-(propan-2-ylamino)propan-2-ol hydrochloride |
| Synonyms | Source |
|---|---|
| 1-[4-(2-Cyclopropylmethoxy-ethyl)-phenoxy]-3-isopropylamino-propan-2-ol; hydrochloride | ChEMBL |
| 1-(p-(2-(cyclopropylmethoxy)ethyl)phenoxy)-3-(isopropylamino)-2-propanol hydrochloride | ChemIDplus |
| 1-(isopropylamino)-3-[p-(cyclopropylmethoxyethyl)phenoxy]-2-propanol hydrochloride | ChEBI |
| 3-{4-[2-(cyclopropylmethoxy)ethyl]phenoxy}-2-hydroxy-N-(propan-2-yl)propan-1-aminium chloride | IUPAC |
| betaxolol HCl | ChemIDplus |
| Betaxolol hydrochloride | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5182512 | Beilstein |
| CAS:63659-19-8 | ChemIDplus |