EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12 |
| Net Charge | 0 |
| Average Mass | 72.151 |
| Monoisotopic Mass | 72.09390 |
| SMILES | CCC(C)C |
| InChI | InChI=1S/C5H12/c1-4-5(2)3/h5H,4H2,1-3H3 |
| InChIKey | QWTDNUCVQCZILF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | refrigerant A substance used in a thermodynamic heat pump cycle or refrigeration cycle that undergoes a phase change from a gas to a liquid and back. Refrigerants are used in air-conditioning systems and freezers or refrigerators and are assigned a "R" number (by ASHRAE - formerly the American Society of Heating, Refrigerating and Air Conditioning Engineers), which is determined systematically according to their molecular structure. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isopentane (CHEBI:30362) has role refrigerant (CHEBI:78433) |
| isopentane (CHEBI:30362) is a alkane (CHEBI:18310) |
| Incoming Relation(s) |
| 2-methyl-1,2-butanediol (CHEBI:131357) has parent hydride isopentane (CHEBI:30362) |
| 2-methylbutan-1-ol (CHEBI:48945) has parent hydride isopentane (CHEBI:30362) |
| 3-methyl-2-butanol (CHEBI:77517) has parent hydride isopentane (CHEBI:30362) |
| 3-methylbutane-1,2-diol (CHEBI:65058) has parent hydride isopentane (CHEBI:30362) |
| isoamylol (CHEBI:15837) has parent hydride isopentane (CHEBI:30362) |
| isopentenol (CHEBI:77922) has parent hydride isopentane (CHEBI:30362) |
| tert-pentyl group (CHEBI:30360) is substituent group from isopentane (CHEBI:30362) |
| 3-methylbutan-2-yl group (CHEBI:32882) is substituent group from isopentane (CHEBI:30362) |
| isopentyl group (CHEBI:30359) is substituent group from isopentane (CHEBI:30362) |
| IUPAC Names |
|---|
| 2-methylbutane |
| isopentane |
| Synonyms | Source |
|---|---|
| 1,1,2-trimethylethane | NIST Chemistry WebBook |
| 1,1-dimethylpropane | NIST Chemistry WebBook |
| (CH3)2CH‒CH2‒CH3 | IUPAC |
| dimethylethylmethane | ChemIDplus |
| isoamylhydride | ChemIDplus |
| iso-C5H12 | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| Isopentane | Wikipedia |
| Citations |
|---|