EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:77517 - 3-methyl-2-butanol
| Formula | C5H12O |
| Net Charge | 0 |
| Average Mass | 88.150 |
| Monoisotopic Mass | 88.08882 |
| SMILES | CC(C)C(C)O |
| InChI | InChI=1S/C5H12O/c1-4(2)5(3)6/h4-6H,1-3H3 |
| InChIKey | MXLMTQWGSQIYOW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | polar solvent A solvent that is composed of polar molecules. Polar solvents can dissolve ionic compounds or ionisable covalent compounds. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | polar solvent A solvent that is composed of polar molecules. Polar solvents can dissolve ionic compounds or ionisable covalent compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-2-butanol (CHEBI:77517) has parent hydride isopentane (CHEBI:30362) |
| 3-methyl-2-butanol (CHEBI:77517) has role plant metabolite (CHEBI:76924) |
| 3-methyl-2-butanol (CHEBI:77517) has role polar solvent (CHEBI:48354) |
| 3-methyl-2-butanol (CHEBI:77517) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 3-methylbutan-2-ol |
| Synonyms | Source |
|---|---|
| 2-Methyl-3-butanol | ChemIDplus |
| Isopropylmethylcarbinol | ChemIDplus |
| 1,2-Dimethylpropanol | ChemIDplus |
| 1,2-Dimethyl-1-propanol | NIST Chemistry WebBook |
| Methylisopropylcarbinol | ChemIDplus |
| sec-Isoamyl alcohol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033777 | HMDB |
| 3-Methyl-2-butanol | Wikipedia |
| Citations |
|---|