EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12O2 |
| Net Charge | 0 |
| Average Mass | 104.149 |
| Monoisotopic Mass | 104.08373 |
| SMILES | CC(C)C(O)CO |
| InChI | InChI=1S/C5H12O2/c1-4(2)5(7)3-6/h4-7H,3H2,1-2H3 |
| InChIKey | HJJZIMFAIMUSBW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylbutane-1,2-diol (CHEBI:65058) has parent hydride isopentane (CHEBI:30362) |
| 3-methylbutane-1,2-diol (CHEBI:65058) has role metabolite (CHEBI:25212) |
| 3-methylbutane-1,2-diol (CHEBI:65058) is a glycol (CHEBI:13643) |
| Incoming Relation(s) |
| 1-hydroxy-3-methylbutan-2-one (CHEBI:195497) has functional parent 3-methylbutane-1,2-diol (CHEBI:65058) |
| IUPAC Name |
|---|
| 3-methylbutane-1,2-diol |
| Synonyms | Source |
|---|---|
| 3-methyl-1,2-dihydroxybutane | ChEBI |
| 1,2-dihydroxy-3-methylbutane | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1719144 | Reaxys |
| CAS:50468-22-9 | ChemIDplus |
| CAS:50468-22-9 | NIST Chemistry WebBook |
| Citations |
|---|