EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30245 - linoleate
| Formula | C18H31O2 |
| Net Charge | -1 |
| Average Mass | 279.444 |
| Monoisotopic Mass | 279.23295 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/p-1/b7-6-,10-9- |
| InChIKey | OYHQOLUKZRVURQ-HZJYTTRNSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS90) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linoleate (CHEBI:30245) has functional parent 9-HPODE(1−) (CHEBI:146293) |
| linoleate (CHEBI:30245) has role human blood serum metabolite (CHEBI:85234) |
| linoleate (CHEBI:30245) has role plant metabolite (CHEBI:76924) |
| linoleate (CHEBI:30245) is a octadecadienoate (CHEBI:25626) |
| linoleate (CHEBI:30245) is conjugate base of linoleic acid (CHEBI:17351) |
| Incoming Relation(s) |
| (S)-3-hydroxylinoleoyl-CoA(4−) (CHEBI:233824) has functional parent linoleate (CHEBI:30245) |
| (9S),10-epoxy-(10,12Z)-octadecadienoate (CHEBI:143139) has functional parent linoleate (CHEBI:30245) |
| (9Z,12Z)-11-hydroxyoctadecadienoate (CHEBI:136522) has functional parent linoleate (CHEBI:30245) |
| N-linoleoylglycine(1−) (CHEBI:150011) has functional parent linoleate (CHEBI:30245) |
| 1,1',2-trilinoleoyl-2'-palmitoleoyl-cardiolipin(2−) (CHEBI:176427) has functional parent linoleate (CHEBI:30245) |
| 1,1',2-trioleoyl-2'-linoleoyl-cardiolipin(2−) (CHEBI:173223) has functional parent linoleate (CHEBI:30245) |
| 13-HODE(1−) (CHEBI:133819) has functional parent linoleate (CHEBI:30245) |
| 9-HODE(1−) (CHEBI:133820) has functional parent linoleate (CHEBI:30245) |
| trininoleoyl-monolysocardiolipin(2−) (CHEBI:156311) has functional parent linoleate (CHEBI:30245) |
| Calcium linoleate (CHEBI:31343) has part linoleate (CHEBI:30245) |
| tetralinoleoyl cardiolipin ketone(2−) (CHEBI:231791) has part linoleate (CHEBI:30245) |
| linoleic acid (CHEBI:17351) is conjugate acid of linoleate (CHEBI:30245) |
| IUPAC Name |
|---|
| (9Z,12Z)-octadeca-9,12-dienoate |
| Synonyms | Source |
|---|---|
| (9Z,12Z)-9,12-octadecadienoic acid, ion(1−) | ChemIDplus |
| (Z,Z)-9,12-octadecadienoic acid, ion(1−) | ChemIDplus |
| linoleic acid, ion(1−) | ChemIDplus |
| cis,cis-9,12-octadecadienoate | ChEBI |
| cis,cis-linoleate | ChEBI |
| cis-Δ9,12-octadecadienoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (9Z,12Z)-octadecadienoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01595 | KEGG COMPOUND |
| LINOLEIC_ACID | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:667201 | Gmelin |
| Reaxys:4139597 | Reaxys |
| CAS:1509-85-9 | ChemIDplus |