EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N6O5Se |
| Net Charge | 0 |
| Average Mass | 431.311 |
| Monoisotopic Mass | 432.06604 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](C[Se]CC[C@H](N)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H20N6O5Se/c15-6(14(23)24)1-2-26-3-7-9(21)10(22)13(25-7)20-5-19-8-11(16)17-4-18-12(8)20/h4-7,9-10,13,21-22H,1-3,15H2,(H,23,24)(H2,16,17,18)/t6-,7+,9+,10+,13+/m0/s1 |
| InChIKey | UVSMMLABJBJNGH-WFMPWKQPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-adenosylselenohomocysteine (CHEBI:77028) has functional parent L-selenomethionine (CHEBI:30021) |
| L-adenosylselenohomocysteine (CHEBI:77028) has functional parent adenosine (CHEBI:16335) |
| L-adenosylselenohomocysteine (CHEBI:77028) has role metabolite (CHEBI:25212) |
| L-adenosylselenohomocysteine (CHEBI:77028) is a adenosines (CHEBI:22260) |
| L-adenosylselenohomocysteine (CHEBI:77028) is a selenoamino acid (CHEBI:26629) |
| IUPAC Name |
|---|
| 5'-Se-[(3S)-3-amino-3-carboxypropyl]-5'-selenoadenosine |
| Synonyms | Source |
|---|---|
| Se-Adenosyl-L-selenohomocysteine | KEGG COMPOUND |
| Se-Adenosylselenohomocysteine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05692 | KEGG COMPOUND |
| HMDB0011117 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22733946 | Reaxys |