EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19O9 |
| Net Charge | -1 |
| Average Mass | 367.330 |
| Monoisotopic Mass | 367.10346 |
| SMILES | COc1cc(/C=C/C(=O)O[C@H]2[C@H](O)C[C@](O)(C(=O)[O-])C[C@H]2O)ccc1O |
| InChI | InChI=1S/C17H20O9/c1-25-13-6-9(2-4-10(13)18)3-5-14(21)26-15-11(19)7-17(24,16(22)23)8-12(15)20/h2-6,11-12,15,18-20,24H,7-8H2,1H3,(H,22,23)/p-1/b5-3+/t11-,12-,15-,17+/m1/s1 |
| InChIKey | VTMFDSJJVNQXLT-KSQYBWRXSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-O-feruloyl-D-quinate (CHEBI:60078) has functional parent (−)-quinate (CHEBI:29751) |
| 4-O-feruloyl-D-quinate (CHEBI:60078) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| 4-O-feruloyl-D-quinate (CHEBI:60078) is conjugate base of 4-O-feruloyl-D-quinic acid (CHEBI:18013) |
| Incoming Relation(s) |
| 4-O-feruloyl-D-quinic acid (CHEBI:18013) is conjugate acid of 4-O-feruloyl-D-quinate (CHEBI:60078) |
| IUPAC Name |
|---|
| (1S,3R,4S,5R)-1,3,5-trihydroxy-4-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}cyclohexanecarboxylate |
| Synonym | Source |
|---|---|
| 4-O-feruloyl-D-quinate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-O-feruloyl-D-quinate | UniProt |