EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12ClNO2 |
| Net Charge | 0 |
| Average Mass | 213.664 |
| Monoisotopic Mass | 213.05566 |
| SMILES | NCC(CC(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H12ClNO2/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8H,5-6,12H2,(H,13,14) |
| InChIKey | KPYSYYIEGFHWSV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | GABA agonist A drug that binds to and activates γ-aminobutyric acid receptors. |
| Applications: | central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. GABA agonist A drug that binds to and activates γ-aminobutyric acid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| baclofen (CHEBI:2972) has role central nervous system depressant (CHEBI:35488) |
| baclofen (CHEBI:2972) has role GABA agonist (CHEBI:51373) |
| baclofen (CHEBI:2972) has role muscle relaxant (CHEBI:51371) |
| baclofen (CHEBI:2972) is a monocarboxylic acid (CHEBI:25384) |
| baclofen (CHEBI:2972) is a monochlorobenzenes (CHEBI:83403) |
| baclofen (CHEBI:2972) is a primary amino compound (CHEBI:50994) |
| baclofen (CHEBI:2972) is a γ-amino acid (CHEBI:33707) |
| baclofen (CHEBI:2972) is tautomer of baclofen zwitterion (CHEBI:187893) |
| Incoming Relation(s) |
| baclofen zwitterion (CHEBI:187893) is tautomer of baclofen (CHEBI:2972) |
| IUPAC Name |
|---|
| 4-amino-3-(4-chlorophenyl)butanoic acid |
| INNs | Source |
|---|---|
| baclofen | WHO MedNet |
| baclofène | WHO MedNet |
| baclofeno | WHO MedNet |
| baclofenum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-Amino-3-(4-chlorophenyl)butyric acid | ChemIDplus |
| (+-)-Baclofen | ChemIDplus |
| beta-(4-Chlorophenyl)gaba | ChemIDplus |
| beta-(Aminomethyl)-4-chlorobenzenepropanoic acid | ChemIDplus |
| beta-(Aminomethyl)-p-chlorohydrocinnamic acid | ChemIDplus |
| beta-(p-Chlorophenyl)-gamma-aminobutyric acid | ChemIDplus |
| Citations |
|---|