EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12ClNO2 |
| Net Charge | 0 |
| Average Mass | 213.664 |
| Monoisotopic Mass | 213.05566 |
| SMILES | [NH3+]CC(CC(=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H12ClNO2/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8H,5-6,12H2,(H,13,14) |
| InChIKey | KPYSYYIEGFHWSV-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| baclofen zwitterion (CHEBI:187893) is a amino-acid zwitterion (CHEBI:35238) |
| baclofen zwitterion (CHEBI:187893) is tautomer of baclofen (CHEBI:2972) |
| Incoming Relation(s) |
| baclofen (CHEBI:2972) is tautomer of baclofen zwitterion (CHEBI:187893) |
| UniProt Name | Source |
|---|---|
| baclofen | UniProt |