EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24ClN3O |
| Net Charge | 0 |
| Average Mass | 381.907 |
| Monoisotopic Mass | 381.16079 |
| SMILES | CN1CCCC(n2nc(Cc3ccc(Cl)cc3)c3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C22H24ClN3O/c1-25-13-4-5-18(12-14-25)26-22(27)20-7-3-2-6-19(20)21(24-26)15-16-8-10-17(23)11-9-16/h2-3,6-11,18H,4-5,12-15H2,1H3 |
| InChIKey | MBUVEWMHONZEQD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-asthmatic drug A drug used to treat asthma. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azelastine (CHEBI:2950) has role anti-allergic agent (CHEBI:50857) |
| azelastine (CHEBI:2950) has role anti-asthmatic drug (CHEBI:49167) |
| azelastine (CHEBI:2950) has role bronchodilator agent (CHEBI:35523) |
| azelastine (CHEBI:2950) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| azelastine (CHEBI:2950) has role H1-receptor antagonist (CHEBI:37955) |
| azelastine (CHEBI:2950) has role platelet aggregation inhibitor (CHEBI:50427) |
| azelastine (CHEBI:2950) is a monochlorobenzenes (CHEBI:83403) |
| azelastine (CHEBI:2950) is a phthalazines (CHEBI:38768) |
| azelastine (CHEBI:2950) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| azelastine hydrochloride (CHEBI:2951) has part azelastine (CHEBI:2950) |
| (R)-azelastine (CHEBI:55362) is a azelastine (CHEBI:2950) |
| (S)-azelastine (CHEBI:55363) is a azelastine (CHEBI:2950) |
| IUPAC Name |
|---|
| 4-(4-chlorobenzyl)-2-(1-methylazepan-4-yl)phthalazin-1(2H)-one |
| INNs | Source |
|---|---|
| azelastina | DrugBank |
| azelastine | KEGG DRUG |
| azélastine | WHO MedNet |
| azelastinum | DrugBank |
| Synonym | Source |
|---|---|
| 4-(p-Chlorobenzyl)-2-(hexahydro-1-methyl-1H-azepin-4-yl)-1-(2H)-phthalazinone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:900747 | Reaxys |
| CAS:58581-89-8 | ChemIDplus |
| CAS:58581-89-8 | KEGG COMPOUND |
| CAS:58581-89-8 | KEGG DRUG |
| CAS:58581-89-8 | DrugBank |
| Citations |
|---|