EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24ClN3O |
| Net Charge | 0 |
| Average Mass | 381.907 |
| Monoisotopic Mass | 381.16079 |
| SMILES | CN1CCCC(n2nc(Cc3ccc(Cl)cc3)c3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C22H24ClN3O/c1-25-13-4-5-18(12-14-25)26-22(27)20-7-3-2-6-19(20)21(24-26)15-16-8-10-17(23)11-9-16/h2-3,6-11,18H,4-5,12-15H2,1H3 |
| InChIKey | MBUVEWMHONZEQD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. anti-allergic agent A drug used to treat allergic reactions. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. anti-asthmatic drug A drug used to treat asthma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azelastine (CHEBI:2950) has role anti-allergic agent (CHEBI:50857) |
| azelastine (CHEBI:2950) has role anti-asthmatic drug (CHEBI:49167) |
| azelastine (CHEBI:2950) has role bronchodilator agent (CHEBI:35523) |
| azelastine (CHEBI:2950) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| azelastine (CHEBI:2950) has role H1-receptor antagonist (CHEBI:37955) |
| azelastine (CHEBI:2950) has role nasal decongestant (CHEBI:77715) |
| azelastine (CHEBI:2950) has role platelet aggregation inhibitor (CHEBI:50427) |
| azelastine (CHEBI:2950) is a monochlorobenzenes (CHEBI:83403) |
| azelastine (CHEBI:2950) is a phthalazines (CHEBI:38768) |
| azelastine (CHEBI:2950) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| azelastine hydrochloride (CHEBI:2951) has part azelastine (CHEBI:2950) |
| (R)-azelastine (CHEBI:55362) is a azelastine (CHEBI:2950) |
| (S)-azelastine (CHEBI:55363) is a azelastine (CHEBI:2950) |
| IUPAC Name |
|---|
| 4-(4-chlorobenzyl)-2-(1-methylazepan-4-yl)phthalazin-1(2H)-one |
| INNs | Source |
|---|---|
| azelastina | DrugBank |
| azelastine | KEGG DRUG |
| azélastine | WHO MedNet |
| azelastinum | DrugBank |
| Synonyms | Source |
|---|---|
| 4-(p-Chlorobenzyl)-2-(hexahydro-1-methyl-1H-azepin-4-yl)-1-(2H)-phthalazinone | ChemIDplus |
| NSC-758971 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:900747 | Reaxys |
| CAS:58581-89-8 | DrugBank |
| CAS:58581-89-8 | KEGG DRUG |
| CAS:58581-89-8 | KEGG COMPOUND |
| CAS:58581-89-8 | ChemIDplus |
| Citations |
|---|