EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2951 - azelastine hydrochloride
| Formula | C22H24ClN3O.HCl |
| Net Charge | 0 |
| Average Mass | 418.368 |
| Monoisotopic Mass | 417.13747 |
| SMILES | CN1CCCC(n2nc(Cc3ccc(Cl)cc3)c3ccccc3c2=O)CC1.Cl |
| InChI | InChI=1S/C22H24ClN3O.ClH/c1-25-13-4-5-18(12-14-25)26-22(27)20-7-3-2-6-19(20)21(24-26)15-16-8-10-17(23)11-9-16;/h2-3,6-11,18H,4-5,12-15H2,1H3;1H |
| InChIKey | YEJAJYAHJQIWNU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. anti-allergic agent A drug used to treat allergic reactions. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. anti-asthmatic drug A drug used to treat asthma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azelastine hydrochloride (CHEBI:2951) has part azelastine (CHEBI:2950) |
| azelastine hydrochloride (CHEBI:2951) has role anti-allergic agent (CHEBI:50857) |
| azelastine hydrochloride (CHEBI:2951) has role anti-asthmatic drug (CHEBI:49167) |
| azelastine hydrochloride (CHEBI:2951) has role bronchodilator agent (CHEBI:35523) |
| azelastine hydrochloride (CHEBI:2951) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| azelastine hydrochloride (CHEBI:2951) has role H1-receptor antagonist (CHEBI:37955) |
| azelastine hydrochloride (CHEBI:2951) has role nasal decongestant (CHEBI:77715) |
| azelastine hydrochloride (CHEBI:2951) has role ophthalmology drug (CHEBI:66981) |
| azelastine hydrochloride (CHEBI:2951) has role platelet aggregation inhibitor (CHEBI:50427) |
| azelastine hydrochloride (CHEBI:2951) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 4-(4-chlorobenzyl)-2-(1-methylazepan-4-yl)phthalazin-1(2H)-one hydrochloride |
| INNs | Source |
|---|---|
| azelastina | DrugBank |
| azelastine | ChEBI |
| azelastinum | DrugBank |
| Synonyms | Source |
|---|---|
| 4-(p-Chlorobenzyl)-2-(hexahydro-1-methyl-1H-azepin-4-yl)-1(2H)-phthalazinone monohydrochloride | ChemIDplus |
| A-5610 | ChEMBL |
| Azelastine HCl | ChemIDplus |
| E-0659 | ChEMBL |
| W-2979M | ChEMBL |
| Brand Names | Source |
|---|---|
| Astelin | ChEMBL |
| Astepro | ChEMBL |
| Astepro allergy | ChEMBL |
| Azelastine hydrochloride component of dymista | ChEMBL |
| Children's astepro allergy | ChEMBL |
| Optilast | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4834474 | Beilstein |
| CAS:79307-93-0 | ChemIDplus |
| CAS:79307-93-0 | KEGG DRUG |
| Citations |
|---|