EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO4 |
| Net Charge | 0 |
| Average Mass | 183.163 |
| Monoisotopic Mass | 183.05316 |
| SMILES | [NH3+][C@H](C(=O)[O-])c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C8H9NO4/c9-7(8(12)13)4-1-5(10)3-6(11)2-4/h1-3,7,10-11H,9H2,(H,12,13)/t7-/m0/s1 |
| InChIKey | HOOWCUZPEFNHDT-ZETCQYMHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3,5-dihydroxyphenylglycine zwitterion (CHEBI:75204) is a amino-acid zwitterion (CHEBI:35238) |
| (S)-3,5-dihydroxyphenylglycine zwitterion (CHEBI:75204) is tautomer of (S)-3,5-dihydroxyphenylglycine (CHEBI:29474) |
| Incoming Relation(s) |
| (S)-3,5-dihydroxyphenylglycine (CHEBI:29474) is tautomer of (S)-3,5-dihydroxyphenylglycine zwitterion (CHEBI:75204) |
| IUPAC Name |
|---|
| (2S)-azaniumyl(3,5-dihydroxyphenyl)acetate |
| UniProt Name | Source |
|---|---|
| (S)-3,5-dihydroxyphenylglycine | UniProt |