EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9ClO4 |
| Net Charge | 0 |
| Average Mass | 252.653 |
| Monoisotopic Mass | 252.01894 |
| SMILES | O=C(O)/C(O)=C\C=C/C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H9ClO4/c13-9-6-4-8(5-7-9)10(14)2-1-3-11(15)12(16)17/h1-7,15H,(H,16,17)/b2-1-,11-3+ |
| InChIKey | BKVFPMUIZMNOHF-QRLZPCCQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,4Z)-6-(4-chlorophenyl)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:28978) has functional parent sorbic acid (CHEBI:35962) |
| (2E,4Z)-6-(4-chlorophenyl)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:28978) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| (2E,4Z)-6-(4-chlorophenyl)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:28978) is a 6-oxo monocarboxylic acid (CHEBI:35960) |
| (2E,4Z)-6-(4-chlorophenyl)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:28978) is a monochlorobenzenes (CHEBI:83403) |
| (2E,4Z)-6-(4-chlorophenyl)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:28978) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E,4Z)-6-(4-chlorophenyl)-2-hydroxy-6-oxohexa-2,4-dienoic acid |
| Synonym | Source |
|---|---|
| 2-Hydroxy-6-oxo-6-(4'-chlorophenyl)-hexa-2,4-dienoate | KEGG COMPOUND |
| Citations |
|---|