EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O |
| Net Charge | 0 |
| Average Mass | 396.659 |
| Monoisotopic Mass | 396.33922 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)CCC1=C |
| InChI | InChI=1S/C28H44O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h9-10,12-13,19-20,22,25-27,29H,4,7-8,11,14-18H2,1-3,5-6H3/b10-9+,23-12+,24-13-/t20-,22+,25-,26+,27-,28+/m0/s1 |
| InChIKey | MECHNRXZTMCUDQ-RKHKHRCZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood plasma (BTO:0000118) | PubMed (227368) | ||
| saliva (UBERON:0001836) | Article (Dame, ZT. et al. (2014) The Human Saliva Metabolome (manuscript in preparation)) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Applications: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. rodenticide A substance used to destroy rodent pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vitamin D2 (CHEBI:28934) has role bone density conservation agent (CHEBI:50646) |
| vitamin D2 (CHEBI:28934) has role nutraceutical (CHEBI:50733) |
| vitamin D2 (CHEBI:28934) has role plant metabolite (CHEBI:76924) |
| vitamin D2 (CHEBI:28934) has role rodenticide (CHEBI:33288) |
| vitamin D2 (CHEBI:28934) is a hydroxy seco-steroid (CHEBI:36853) |
| vitamin D2 (CHEBI:28934) is a seco-ergostane (CHEBI:36819) |
| vitamin D2 (CHEBI:28934) is a vitamin D (CHEBI:27300) |
| Incoming Relation(s) |
| 1α,25-dihydroxyvitamin D2 (CHEBI:86320) has functional parent vitamin D2 (CHEBI:28934) |
| 25-hydroxyvitamin D2 (CHEBI:86319) has functional parent vitamin D2 (CHEBI:28934) |
| paricalcitol (CHEBI:7931) has functional parent vitamin D2 (CHEBI:28934) |
| IUPAC Name |
|---|
| (3S,5Z,7E,22E)-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol |
| INNs | Source |
|---|---|
| ergocalciferol | WHO MedNet |
| ergocalciferol | WHO MedNet |
| ergocalciférol | WHO MedNet |
| ergocalciferolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (3β,5Z,7E,22E)-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol | NIST Chemistry WebBook |
| (5Z,7E,22E)-(3S)-9,10-seco-5,7,10(19),22-ergostatetraen-3-ol | LIPID MAPS |
| (5Z,7E,22E)-(3S)-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol | JCBN |
| activated ergosterol | ChemIDplus |
| calciferol | ChemIDplus |
| ercalciol | JCBN |
| Brand Names | Source |
|---|---|
| Buco-D | ChemIDplus |
| Decaps | ChemIDplus |
| Dee-Ron | ChemIDplus |
| Deltalin | ChemIDplus |
| Diactol | ChemIDplus |
| Doral | ChemIDplus |
| UniProt Name | Source |
|---|---|
| vitamin D2 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 107 | PPDB |
| 2838 | DrugCentral |
| 4444351 | ChemSpider |
| C05441 | KEGG COMPOUND |
| D00187 | KEGG DRUG |
| D2V | PDBeChem |
| DB00153 | DrugBank |
| Ergocalciferol | Wikipedia |
| FDB012811 | FooDB |
| HMDB0000900 | HMDB |
| LMST03010001 | LIPID MAPS |
| US1680818 | Patent |
| US1871136 | Patent |
| US1902785 | Patent |
| US2030792 | Patent |
| VITAMIN_D2 | MetaCyc |
| Citations |
|---|