EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O2 |
| Net Charge | 0 |
| Average Mass | 412.658 |
| Monoisotopic Mass | 412.33413 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)CCC1=C |
| InChI | InChI=1S/C28H44O2/c1-19-10-14-24(29)18-23(19)13-12-22-8-7-17-28(6)25(15-16-26(22)28)20(2)9-11-21(3)27(4,5)30/h9,11-13,20-21,24-26,29-30H,1,7-8,10,14-18H2,2-6H3/b11-9+,22-12+,23-13-/t20-,21+,24+,25-,26+,28-/m1/s1 |
| InChIKey | KJKIIUAXZGLUND-ICCVIKJNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (15465040) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Applications: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 25-hydroxyvitamin D2 (CHEBI:86319) has functional parent vitamin D2 (CHEBI:28934) |
| 25-hydroxyvitamin D2 (CHEBI:86319) has role bone density conservation agent (CHEBI:50646) |
| 25-hydroxyvitamin D2 (CHEBI:86319) has role human xenobiotic metabolite (CHEBI:76967) |
| 25-hydroxyvitamin D2 (CHEBI:86319) has role nutraceutical (CHEBI:50733) |
| 25-hydroxyvitamin D2 (CHEBI:86319) is a hydroxycalciol (CHEBI:47042) |
| 25-hydroxyvitamin D2 (CHEBI:86319) is a seco-ergostane (CHEBI:36819) |
| 25-hydroxyvitamin D2 (CHEBI:86319) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (3S,5Z,7E,22E)-9,10-secoergosta-5,7,10,22-tetraene-3,25-diol |
| Synonyms | Source |
|---|---|
| 25-Hydroxycalciferol | HMDB |
| 25-hydroxyergocalciferol | LIPID MAPS |
| 9,10-secoergosta-5,7,10(19),22-tetraene-3β,25-diol | HMDB |
| ercalcidiol | HMDB |
| UniProt Name | Source |
|---|---|
| 25-hydroxyvitamin D2 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001438 | HMDB |
| LMST03010030 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4716773 | Reaxys |
| CAS:21343-40-8 | ChemIDplus |
| Citations |
|---|