EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7931 - paricalcitol
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1C[C@@H](O)C[C@H](O)C1 |
| InChI | InChI=1S/C27H44O3/c1-18(8-9-19(2)26(3,4)30)24-12-13-25-21(7-6-14-27(24,25)5)11-10-20-15-22(28)17-23(29)16-20/h8-11,18-19,22-25,28-30H,6-7,12-17H2,1-5H3/b9-8+,21-11+/t18-,19+,22-,23-,24-,25+,27-/m1/s1 |
| InChIKey | BPKAHTKRCLCHEA-UBFJEZKGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antiparathyroid drug A drug used to treat hyperparathyroidism by reducing the excessive production of parathyroid hormones. |
| Applications: | antiparathyroid drug A drug used to treat hyperparathyroidism by reducing the excessive production of parathyroid hormones. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hypoglycemic agent A drug which lowers the blood glucose level. renoprotective agent Any compound that is able to prevent damage to the kidneys. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paricalcitol (CHEBI:7931) has functional parent vitamin D2 (CHEBI:28934) |
| paricalcitol (CHEBI:7931) has role antineoplastic agent (CHEBI:35610) |
| paricalcitol (CHEBI:7931) has role antiparathyroid drug (CHEBI:50827) |
| paricalcitol (CHEBI:7931) has role hypoglycemic agent (CHEBI:35526) |
| paricalcitol (CHEBI:7931) has role nephroprotective agent (CHEBI:76595) |
| paricalcitol (CHEBI:7931) has role renoprotective agent (CHEBI:231911) |
| paricalcitol (CHEBI:7931) is a hydroxy seco-steroid (CHEBI:36853) |
| paricalcitol (CHEBI:7931) is a seco-cholestane (CHEBI:36818) |
| IUPAC Name |
|---|
| (1R,3R,7E)-17β-[(2R,3E,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-9,10-secoestra-5,7-diene-1,3-diol |
| INN | Source |
|---|---|
| paricalcitol | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 19-Nor-1alpha,25-dihydroxyvitamin D2 | KEGG COMPOUND |
| COMPOUND 49510 | ChEMBL |
| COMPOUND-49510 | ChEMBL |
| Paricalcitol | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Zemplar | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:131918-61-1 | KEGG COMPOUND |
| CAS:131918-61-1 | ChemIDplus |
| Citations |
|---|