EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1C[C@@H](O)C[C@H](O)C1 |
| InChI | InChI=1S/C27H44O3/c1-18(8-9-19(2)26(3,4)30)24-12-13-25-21(7-6-14-27(24,25)5)11-10-20-15-22(28)17-23(29)16-20/h8-11,18-19,22-25,28-30H,6-7,12-17H2,1-5H3/b9-8+,21-11+/t18-,19+,22-,23-,24-,25+,27-/m1/s1 |
| InChIKey | BPKAHTKRCLCHEA-UBFJEZKGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antiparathyroid drug A drug used to treat hyperparathyroidism by reducing the excessive production of parathyroid hormones. |
| Application: | antiparathyroid drug A drug used to treat hyperparathyroidism by reducing the excessive production of parathyroid hormones. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paricalcitol (CHEBI:7931) has functional parent vitamin D2 (CHEBI:28934) |
| paricalcitol (CHEBI:7931) has role antiparathyroid drug (CHEBI:50827) |
| paricalcitol (CHEBI:7931) is a hydroxy seco-steroid (CHEBI:36853) |
| paricalcitol (CHEBI:7931) is a seco-cholestane (CHEBI:36818) |
| IUPAC Name |
|---|
| (1R,3R,7E)-17β-[(2R,3E,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-9,10-secoestra-5,7-diene-1,3-diol |
| INN | Source |
|---|---|
| paricalcitol | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 19-Nor-1alpha,25-dihydroxyvitamin D2 | KEGG COMPOUND |
| Paricalcitol | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Zemplar | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:131918-61-1 | KEGG COMPOUND |
| CAS:131918-61-1 | ChemIDplus |