EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 305.205 |
| Monoisotopic Mass | 304.07453 |
| SMILES | N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O |
| InChI | InChI=1S/C13H18Cl2N2O2/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19/h1-4,12H,5-9,16H2,(H,18,19)/t12-/m0/s1 |
| InChIKey | SGDBTWWWUNNDEQ-LBPRGKRZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. drug allergen Any drug which causes the onset of an allergic reaction. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| melphalan (CHEBI:28876) has role alkylating agent (CHEBI:22333) |
| melphalan (CHEBI:28876) has role antineoplastic agent (CHEBI:35610) |
| melphalan (CHEBI:28876) has role carcinogenic agent (CHEBI:50903) |
| melphalan (CHEBI:28876) has role drug allergen (CHEBI:88188) |
| melphalan (CHEBI:28876) has role immunosuppressive agent (CHEBI:35705) |
| melphalan (CHEBI:28876) is a L-phenylalanine derivative (CHEBI:84144) |
| melphalan (CHEBI:28876) is a nitrogen mustard (CHEBI:37598) |
| melphalan (CHEBI:28876) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| melphalan (CHEBI:28876) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 4-[bis(2-chloroethyl)amino]-L-phenylalanine |
| INNs | Source |
|---|---|
| melfalano | ChemIDplus |
| melphalan | KEGG DRUG |
| melphalanum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-(p-(Bis(2-chloroethyl)amino)phenyl)-L-alanine | ChemIDplus |
| 3-p-(Di(2-chloroethyl)amino)-phenyl-L-alanine | ChemIDplus |
| 4-(Bis(2-chloroethyl)amino)-L-phenylalanine | ChemIDplus |
| p-N,N-bis(2-chloroethyl)amino-L-phenylalanine | ChEBI |
| L-3-(p-(Bis(2-chloroethyl)amino)phenyl)alanine | ChemIDplus |
| L-PAM | ChemIDplus |
| Citations |
|---|